C30H34N10O2S2 — CID 5470417
1-N,4-N-bis[(E)-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)methylideneamino]piperazine-1,4-dicarbothioamide (PubChem CID 5470417) has the molecular formula C30H34N10O2S2 and a molecular weight of 630.80 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)methylideneamino]piperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-bis[(E)-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)methylideneamino]piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 5470417 |
| Molecular Formula | C30H34N10O2S2 |
| Molecular Weight | 630.80 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 1-N,4-N-bis[(E)-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)methylideneamino]piperazine-1,4-dicarbothioamide |
| SMILES | Cc1c(/C=N/NC(=S)N2CCN(C(=S)N/N=C/c3c(C)n(C)n(-c4ccccc4)c3=O)CC2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C30H34N10O2S2/c1-21-25(27(41)39(35(21)3)23-11-7-5-8-12-23)19-31-33-29(43)37-15-17-38(18-16-37)30(44)34-32-20-26-22(2)36(4)40(28(26)42)24-13-9-6-10-14-24/h5-14,19-20H,15-18H2,1-4H3,(H,33,43)(H,34,44)/b31-19+,32-20+ |
| InChIKey | GWWYAIOHOKAKIV-GKTLAHRSSA-N |
| XLogP | 2.02 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|