C21H20N2O2 — CID 6433853
1,5-dimethyl-4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]-2-phenylpyrazol-3-one (PubChem CID 6433853) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 6433853 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1,5-dimethyl-4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(C(=O)/C=C/c2c(C)n(C)n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C21H20N2O2/c1-15-9-11-17(12-10-15)20(24)14-13-19-16(2)22(3)23(21(19)25)18-7-5-4-6-8-18/h4-14H,1-3H3/b14-13+ |
| InChIKey | DZCKPPBPWVCUSJ-BUHFOSPRSA-N |
| XLogP | 3.69 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|