C19H18BrN5OS — CID 5451516
1-[(Z)-(4-bromophenyl)methylideneamino]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (PubChem CID 5451516) has the molecular formula C19H18BrN5OS and a molecular weight of 444.36 g/mol. Its IUPAC name is 1-[(Z)-(4-bromophenyl)methylideneamino]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea.
| Compound Name | 1-[(Z)-(4-bromophenyl)methylideneamino]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 5451516 |
| Molecular Formula | C19H18BrN5OS |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-[(Z)-(4-bromophenyl)methylideneamino]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| SMILES | Cc1c(NC(=S)N/N=C\c2ccc(Br)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H18BrN5OS/c1-13-17(18(26)25(24(13)2)16-6-4-3-5-7-16)22-19(27)23-21-12-14-8-10-15(20)11-9-14/h3-12H,1-2H3,(H2,22,23,27)/b21-12- |
| InChIKey | KFBJYWNXLRBSEV-MTJSOVHGSA-N |
| XLogP | 3.57 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|