C21H22BrClN4OS — CID 46495119
1-[3-(4-bromophenyl)-2-chloropropyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea (PubChem CID 46495119) has the molecular formula C21H22BrClN4OS and a molecular weight of 493.86 g/mol. Its IUPAC name is 1-[3-(4-bromophenyl)-2-chloropropyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea.
| Compound Name | 1-[3-(4-bromophenyl)-2-chloropropyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 46495119 |
| Molecular Formula | C21H22BrClN4OS |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 1-[3-(4-bromophenyl)-2-chloropropyl]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)thiourea |
| SMILES | Cc1c(NC(=S)NCC(Cl)Cc2ccc(Br)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H22BrClN4OS/c1-14-19(20(28)27(26(14)2)18-6-4-3-5-7-18)25-21(29)24-13-17(23)12-15-8-10-16(22)11-9-15/h3-11,17H,12-13H2,1-2H3,(H2,24,25,29) |
| InChIKey | BWNVPIPTLIQUFF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|