C22H23N5S — CID 6091029
1-[4-(dimethylamino)phenyl]-3-[(Z)-(3-methyl-4-phenyl-2-pyridinyl)methylideneamino]thiourea (PubChem CID 6091029) has the molecular formula C22H23N5S and a molecular weight of 389.53 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[(Z)-(3-methyl-4-phenyl-2-pyridinyl)methylideneamino]thiourea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[(Z)-(3-methyl-4-phenyl-2-pyridinyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6091029 |
| Molecular Formula | C22H23N5S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[(Z)-(3-methyl-4-phenyl-2-pyridinyl)methylideneamino]thiourea |
| SMILES | Cc1c(-c2ccccc2)ccnc1/C=N\NC(=S)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H23N5S/c1-16-20(17-7-5-4-6-8-17)13-14-23-21(16)15-24-26-22(28)25-18-9-11-19(12-10-18)27(2)3/h4-15H,1-3H3,(H2,25,26,28)/b24-15- |
| InChIKey | PGUNOWAWNRLZFD-IWIPYMOSSA-N |
| XLogP | 4.44 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|