C17H18N6S — CID 5474899
1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-(1H-indazol-6-yl)thiourea (PubChem CID 5474899) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-(1H-indazol-6-yl)thiourea.
| Compound Name | 1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-(1H-indazol-6-yl)thiourea |
|---|---|
| PubChem CID | 5474899 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-3-(1H-indazol-6-yl)thiourea |
| SMILES | CN(C)c1ccc(/C=N\NC(=S)Nc2ccc3cn[nH]c3c2)cc1 |
| InChI | InChI=1S/C17H18N6S/c1-23(2)15-7-3-12(4-8-15)10-18-22-17(24)20-14-6-5-13-11-19-21-16(13)9-14/h3-11H,1-2H3,(H,19,21)(H2,20,22,24)/b18-10- |
| InChIKey | PKIBBPUFYZSXSL-ZDLGFXPLSA-N |
| XLogP | 2.95 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|