C15H14N4S — CID 3437722
1-(1H-indazol-6-yl)-3-(3-methylphenyl)thiourea (PubChem CID 3437722) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-(1H-indazol-6-yl)-3-(3-methylphenyl)thiourea.
| Compound Name | 1-(1H-indazol-6-yl)-3-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3437722 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-(1H-indazol-6-yl)-3-(3-methylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C15H14N4S/c1-10-3-2-4-12(7-10)17-15(20)18-13-6-5-11-9-16-19-14(11)8-13/h2-9H,1H3,(H,16,19)(H2,17,18,20) |
| InChIKey | PMVABHHMKSQZQR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|