C13H10N4O2S — CID 91824430
N-(1H-indazol-6-ylcarbamothioyl)furan-2-carboxamide (PubChem CID 91824430) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-(1H-indazol-6-ylcarbamothioyl)furan-2-carboxamide.
| Compound Name | N-(1H-indazol-6-ylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 91824430 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-(1H-indazol-6-ylcarbamothioyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2cn[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C13H10N4O2S/c18-12(11-2-1-5-19-11)16-13(20)15-9-4-3-8-7-14-17-10(8)6-9/h1-7H,(H,14,17)(H2,15,16,18,20) |
| InChIKey | BRFNLPZAFITKEF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|