About 1H-indazol-6-yl furan-2-carboxylate
1H-indazol-6-yl furan-2-carboxylate (PubChem CID 71857506) has the molecular formula C12H8N2O3
and a molecular weight of 228.21 g/mol. Its IUPAC name is 1H-indazol-6-yl furan-2-carboxylate.
Molecular Properties
| Compound Name | 1H-indazol-6-yl furan-2-carboxylate |
| PubChem CID | 71857506 |
| Molecular Formula | C12H8N2O3 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 1H-indazol-6-yl furan-2-carboxylate |
| SMILES | O=C(Oc1ccc2cn[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C12H8N2O3/c15-12(11-2-1-5-16-11)17-9-4-3-8-7-13-14-10(8)6-9/h1-7H,(H,13,14) |
| InChIKey | DFXHOCWDEPAZHG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazol-6-yl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-6-yl furan-2-carboxylate?
The IUPAC name of 1H-indazol-6-yl furan-2-carboxylate (CID 71857506) is 1H-indazol-6-yl furan-2-carboxylate.
What is the SMILES notation for 1H-indazol-6-yl furan-2-carboxylate?
The canonical SMILES for 1H-indazol-6-yl furan-2-carboxylate is O=C(Oc1ccc2cn[nH]c2c1)c1ccco1.
What is the InChIKey of 1H-indazol-6-yl furan-2-carboxylate?
The InChIKey is DFXHOCWDEPAZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3/c15-12(11-2-1-5-16-11)17-9-4-3-8-7-13-14-10(8)6-9/h1-7H,(H,13,14).
What are the key properties of 1H-indazol-6-yl furan-2-carboxylate?
1H-indazol-6-yl furan-2-carboxylate has a molecular weight of 228.21 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-6-yl furan-2-carboxylate is sourced from PubChem (CID 71857506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).