About ethane;6-methoxy-1H-indazole
ethane;6-methoxy-1H-indazole (PubChem CID 144719676) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is ethane;6-methoxy-1H-indazole.
Molecular Properties
| Compound Name | ethane;6-methoxy-1H-indazole |
| PubChem CID | 144719676 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | ethane;6-methoxy-1H-indazole |
| SMILES | CC.COc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C8H8N2O.C2H6/c1-11-7-3-2-6-5-9-10-8(6)4-7;1-2/h2-5H,1H3,(H,9,10);1-2H3 |
| InChIKey | QMHJMJPABHFXHV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-methoxy-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methoxy-1H-indazole?
The IUPAC name of ethane;6-methoxy-1H-indazole (CID 144719676) is ethane;6-methoxy-1H-indazole.
What is the SMILES notation for ethane;6-methoxy-1H-indazole?
The canonical SMILES for ethane;6-methoxy-1H-indazole is CC.COc1ccc2cn[nH]c2c1.
What is the InChIKey of ethane;6-methoxy-1H-indazole?
The InChIKey is QMHJMJPABHFXHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.C2H6/c1-11-7-3-2-6-5-9-10-8(6)4-7;1-2/h2-5H,1H3,(H,9,10);1-2H3.
What are the key properties of ethane;6-methoxy-1H-indazole?
ethane;6-methoxy-1H-indazole has a molecular weight of 178.23 g/mol, XLogP of 2.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methoxy-1H-indazole is sourced from PubChem (CID 144719676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).