About ethene;6-methyl-1H-indazole
ethene;6-methyl-1H-indazole (PubChem CID 123213038) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is ethene;6-methyl-1H-indazole.
Molecular Properties
| Compound Name | ethene;6-methyl-1H-indazole |
| PubChem CID | 123213038 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | ethene;6-methyl-1H-indazole |
| SMILES | C=C.Cc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C8H8N2.C2H4/c1-6-2-3-7-5-9-10-8(7)4-6;1-2/h2-5H,1H3,(H,9,10);1-2H2 |
| InChIKey | OAPXYTYDFGATRB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;6-methyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;6-methyl-1H-indazole?
The IUPAC name of ethene;6-methyl-1H-indazole (CID 123213038) is ethene;6-methyl-1H-indazole.
What is the SMILES notation for ethene;6-methyl-1H-indazole?
The canonical SMILES for ethene;6-methyl-1H-indazole is C=C.Cc1ccc2cn[nH]c2c1.
What is the InChIKey of ethene;6-methyl-1H-indazole?
The InChIKey is OAPXYTYDFGATRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H4/c1-6-2-3-7-5-9-10-8(7)4-6;1-2/h2-5H,1H3,(H,9,10);1-2H2.
What are the key properties of ethene;6-methyl-1H-indazole?
ethene;6-methyl-1H-indazole has a molecular weight of 160.22 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;6-methyl-1H-indazole is sourced from PubChem (CID 123213038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).