About 6-but-1-ynyl-1H-indazole
6-but-1-ynyl-1H-indazole (PubChem CID 58499151) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 6-but-1-ynyl-1H-indazole.
Molecular Properties
| Compound Name | 6-but-1-ynyl-1H-indazole |
| PubChem CID | 58499151 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 6-but-1-ynyl-1H-indazole |
| SMILES | CCC#Cc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C11H10N2/c1-2-3-4-9-5-6-10-8-12-13-11(10)7-9/h5-8H,2H2,1H3,(H,12,13) |
| InChIKey | YFOKBHPQBHMFRX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-but-1-ynyl-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-but-1-ynyl-1H-indazole?
The IUPAC name of 6-but-1-ynyl-1H-indazole (CID 58499151) is 6-but-1-ynyl-1H-indazole.
What is the SMILES notation for 6-but-1-ynyl-1H-indazole?
The canonical SMILES for 6-but-1-ynyl-1H-indazole is CCC#Cc1ccc2cn[nH]c2c1.
What is the InChIKey of 6-but-1-ynyl-1H-indazole?
The InChIKey is YFOKBHPQBHMFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-3-4-9-5-6-10-8-12-13-11(10)7-9/h5-8H,2H2,1H3,(H,12,13).
What are the key properties of 6-but-1-ynyl-1H-indazole?
6-but-1-ynyl-1H-indazole has a molecular weight of 170.21 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-but-1-ynyl-1H-indazole is sourced from PubChem (CID 58499151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).