C11H14N2 — CID 123175477
5,6-diethyl-1H-indazole (PubChem CID 123175477) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 5,6-diethyl-1H-indazole.
| Compound Name | 5,6-diethyl-1H-indazole |
|---|---|
| PubChem CID | 123175477 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 5,6-diethyl-1H-indazole |
| SMILES | CCc1cc2cn[nH]c2cc1CC |
| InChI | InChI=1S/C11H14N2/c1-3-8-5-10-7-12-13-11(10)6-9(8)4-2/h5-7H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | MDOQFWKDLAZTOG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |