C15H15BrN4 — CID 107490746
6-N-(4-bromo-2-ethylphenyl)-1H-indazole-5,6-diamine (PubChem CID 107490746) has the molecular formula C15H15BrN4 and a molecular weight of 331.22 g/mol. Its IUPAC name is 6-N-(4-bromo-2-ethylphenyl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(4-bromo-2-ethylphenyl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107490746 |
| Molecular Formula | C15H15BrN4 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 6-N-(4-bromo-2-ethylphenyl)-1H-indazole-5,6-diamine |
| SMILES | CCc1cc(Br)ccc1Nc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C15H15BrN4/c1-2-9-5-11(16)3-4-13(9)19-15-7-14-10(6-12(15)17)8-18-20-14/h3-8,19H,2,17H2,1H3,(H,18,20) |
| InChIKey | AXDXCECXMJOUMW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|