C14H12BrFN4 — CID 107489222
6-N-[(5-bromo-2-fluorophenyl)methyl]-1H-indazole-5,6-diamine (PubChem CID 107489222) has the molecular formula C14H12BrFN4 and a molecular weight of 335.18 g/mol. Its IUPAC name is 6-N-[(5-bromo-2-fluorophenyl)methyl]-1H-indazole-5,6-diamine.
| Compound Name | 6-N-[(5-bromo-2-fluorophenyl)methyl]-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107489222 |
| Molecular Formula | C14H12BrFN4 |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 6-N-[(5-bromo-2-fluorophenyl)methyl]-1H-indazole-5,6-diamine |
| SMILES | Nc1cc2cn[nH]c2cc1NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C14H12BrFN4/c15-10-1-2-11(16)8(3-10)6-18-14-5-13-9(4-12(14)17)7-19-20-13/h1-5,7,18H,6,17H2,(H,19,20) |
| InChIKey | GXIDCOILTNREHE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|