C15H13N5 — CID 107489977
4-[[(5-amino-1H-indazol-6-yl)amino]methyl]benzonitrile (PubChem CID 107489977) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[[(5-amino-1H-indazol-6-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(5-amino-1H-indazol-6-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107489977 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-[[(5-amino-1H-indazol-6-yl)amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2cc3[nH]ncc3cc2N)cc1 |
| InChI | InChI=1S/C15H13N5/c16-7-10-1-3-11(4-2-10)8-18-15-6-14-12(5-13(15)17)9-19-20-14/h1-6,9,18H,8,17H2,(H,19,20) |
| InChIKey | OPXSZTKYGOAGCR-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|