C14H20N4O — CID 106120243
4-[[(5-amino-1H-indazol-6-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 106120243) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-[[(5-amino-1H-indazol-6-yl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[(5-amino-1H-indazol-6-yl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106120243 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 4-[[(5-amino-1H-indazol-6-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | Nc1cc2cn[nH]c2cc1NCC1CCC(O)CC1 |
| InChI | InChI=1S/C14H20N4O/c15-12-5-10-8-17-18-13(10)6-14(12)16-7-9-1-3-11(19)4-2-9/h5-6,8-9,11,16,19H,1-4,7,15H2,(H,17,18) |
| InChIKey | CSXCGJJYHLQMPF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|