About 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine
6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine (PubChem CID 107490807) has the molecular formula C14H21N5
and a molecular weight of 259.36 g/mol. Its IUPAC name is 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine.
Molecular Properties
| Compound Name | 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine |
| PubChem CID | 107490807 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine |
| SMILES | CC1CCCC(C)N1Nc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C14H21N5/c1-9-4-3-5-10(2)19(9)18-14-7-13-11(6-12(14)15)8-16-17-13/h6-10,18H,3-5,15H2,1-2H3,(H,16,17) |
| InChIKey | SMUVIZYXMIRPRF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine?
The IUPAC name of 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine (CID 107490807) is 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine.
What is the SMILES notation for 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine?
The canonical SMILES for 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine is CC1CCCC(C)N1Nc1cc2[nH]ncc2cc1N.
What is the InChIKey of 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine?
The InChIKey is SMUVIZYXMIRPRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5/c1-9-4-3-5-10(2)19(9)18-14-7-13-11(6-12(14)15)8-16-17-13/h6-10,18H,3-5,15H2,1-2H3,(H,16,17).
What are the key properties of 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine?
6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine has a molecular weight of 259.36 g/mol, XLogP of 2.73, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(2,6-dimethylpiperidin-1-yl)-1H-indazole-5,6-diamine is sourced from PubChem (CID 107490807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).