About 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine
6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine (PubChem CID 107490640) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine.
Molecular Properties
| Compound Name | 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine |
| PubChem CID | 107490640 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine |
| SMILES | CC1(C)CCCCC1Nc1cc2[nH]ncc2cc1N |
| InChI | InChI=1S/C15H22N4/c1-15(2)6-4-3-5-14(15)18-13-8-12-10(7-11(13)16)9-17-19-12/h7-9,14,18H,3-6,16H2,1-2H3,(H,17,19) |
| InChIKey | CBZUHDDPLHJICK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine?
The IUPAC name of 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine (CID 107490640) is 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine.
What is the SMILES notation for 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine?
The canonical SMILES for 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine is CC1(C)CCCCC1Nc1cc2[nH]ncc2cc1N.
What is the InChIKey of 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine?
The InChIKey is CBZUHDDPLHJICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-15(2)6-4-3-5-14(15)18-13-8-12-10(7-11(13)16)9-17-19-12/h7-9,14,18H,3-6,16H2,1-2H3,(H,17,19).
What are the key properties of 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine?
6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine has a molecular weight of 258.37 g/mol, XLogP of 3.53, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-(2,2-dimethylcyclohexyl)-1H-indazole-5,6-diamine is sourced from PubChem (CID 107490640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).