C16H21N3O — CID 119037007
N-(2,2-dimethylcyclopentyl)-2-(1H-indazol-5-yl)acetamide (PubChem CID 119037007) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)-2-(1H-indazol-5-yl)acetamide.
| Compound Name | N-(2,2-dimethylcyclopentyl)-2-(1H-indazol-5-yl)acetamide |
|---|---|
| PubChem CID | 119037007 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)-2-(1H-indazol-5-yl)acetamide |
| SMILES | CC1(C)CCCC1NC(=O)Cc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C16H21N3O/c1-16(2)7-3-4-14(16)18-15(20)9-11-5-6-13-12(8-11)10-17-19-13/h5-6,8,10,14H,3-4,7,9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | PAFJIADXBSOZBC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |