C17H23N3O2 — CID 164629485
N-[2-[(1S,2S)-2-hydroxycyclohexyl]ethyl]-2-(1H-indazol-5-yl)acetamide (PubChem CID 164629485) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[2-[(1S,2S)-2-hydroxycyclohexyl]ethyl]-2-(1H-indazol-5-yl)acetamide.
| Compound Name | N-[2-[(1S,2S)-2-hydroxycyclohexyl]ethyl]-2-(1H-indazol-5-yl)acetamide |
|---|---|
| PubChem CID | 164629485 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[2-[(1S,2S)-2-hydroxycyclohexyl]ethyl]-2-(1H-indazol-5-yl)acetamide |
| SMILES | O=C(Cc1ccc2[nH]ncc2c1)NCC[C@@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H23N3O2/c21-16-4-2-1-3-13(16)7-8-18-17(22)10-12-5-6-15-14(9-12)11-19-20-15/h5-6,9,11,13,16,21H,1-4,7-8,10H2,(H,18,22)(H,19,20)/t13-,16-/m0/s1 |
| InChIKey | SRCYGSBGUHRNBC-BBRMVZONSA-N |
| XLogP | 2.16 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |