C22H22N6O2 — CID 154862895
N-[[2-(1H-indazole-5-carbonylamino)cyclopentyl]methyl]-1H-indazole-5-carboxamide (PubChem CID 154862895) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[[2-(1H-indazole-5-carbonylamino)cyclopentyl]methyl]-1H-indazole-5-carboxamide.
| Compound Name | N-[[2-(1H-indazole-5-carbonylamino)cyclopentyl]methyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 154862895 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-[[2-(1H-indazole-5-carbonylamino)cyclopentyl]methyl]-1H-indazole-5-carboxamide |
| SMILES | O=C(NCC1CCCC1NC(=O)c1ccc2[nH]ncc2c1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C22H22N6O2/c29-21(13-4-6-19-16(8-13)11-24-27-19)23-10-15-2-1-3-18(15)26-22(30)14-5-7-20-17(9-14)12-25-28-20/h4-9,11-12,15,18H,1-3,10H2,(H,23,29)(H,24,27)(H,25,28)(H,26,30) |
| InChIKey | IIPKEBVIGFMANY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |