C16H22N4O — CID 97056408
N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-1H-indazole-5-carboxamide (PubChem CID 97056408) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-1H-indazole-5-carboxamide.
| Compound Name | N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 97056408 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-1H-indazole-5-carboxamide |
| SMILES | CN(C)[C@@H]1CCC[C@@H](NC(=O)c2ccc3[nH]ncc3c2)C1 |
| InChI | InChI=1S/C16H22N4O/c1-20(2)14-5-3-4-13(9-14)18-16(21)11-6-7-15-12(8-11)10-17-19-15/h6-8,10,13-14H,3-5,9H2,1-2H3,(H,17,19)(H,18,21)/t13-,14-/m1/s1 |
| InChIKey | LYNRQZNPFUGZEO-ZIAGYGMSSA-N |
| XLogP | 2.17 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |