About N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide
N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide (PubChem CID 97068063) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide |
| PubChem CID | 97068063 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N[C@@H]2CCC[C@@H](N(C)C)C2)c1 |
| InChI | InChI=1S/C17H26N2O/c1-12-8-13(2)10-14(9-12)17(20)18-15-6-5-7-16(11-15)19(3)4/h8-10,15-16H,5-7,11H2,1-4H3,(H,18,20)/t15-,16-/m1/s1 |
| InChIKey | FHVLQKQBMXRBOH-HZPDHXFCSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide?
The IUPAC name of N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide (CID 97068063) is N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide.
What is the SMILES notation for N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide?
The canonical SMILES for N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide is Cc1cc(C)cc(C(=O)N[C@@H]2CCC[C@@H](N(C)C)C2)c1.
What is the InChIKey of N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide?
The InChIKey is FHVLQKQBMXRBOH-HZPDHXFCSA-N. The full InChI is InChI=1S/C17H26N2O/c1-12-8-13(2)10-14(9-12)17(20)18-15-6-5-7-16(11-15)19(3)4/h8-10,15-16H,5-7,11H2,1-4H3,(H,18,20)/t15-,16-/m1/s1.
What are the key properties of N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide?
N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide has a molecular weight of 274.41 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,3R)-3-(dimethylamino)cyclohexyl]-3,5-dimethylbenzamide is sourced from PubChem (CID 97068063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).