C14H17N3O2 — CID 126835076
cyclobutyl N-[2-(1H-indazol-5-yl)ethyl]carbamate (PubChem CID 126835076) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is cyclobutyl N-[2-(1H-indazol-5-yl)ethyl]carbamate.
| Compound Name | cyclobutyl N-[2-(1H-indazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 126835076 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | cyclobutyl N-[2-(1H-indazol-5-yl)ethyl]carbamate |
| SMILES | O=C(NCCc1ccc2[nH]ncc2c1)OC1CCC1 |
| InChI | InChI=1S/C14H17N3O2/c18-14(19-12-2-1-3-12)15-7-6-10-4-5-13-11(8-10)9-16-17-13/h4-5,8-9,12H,1-3,6-7H2,(H,15,18)(H,16,17) |
| InChIKey | KRMSKXRRKGYLTI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |