C16H16N4 — CID 107844682
6-N-(2,3-dihydro-1H-inden-2-yl)-1H-indazole-5,6-diamine (PubChem CID 107844682) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-N-(2,3-dihydro-1H-inden-2-yl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(2,3-dihydro-1H-inden-2-yl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107844682 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 6-N-(2,3-dihydro-1H-inden-2-yl)-1H-indazole-5,6-diamine |
| SMILES | Nc1cc2cn[nH]c2cc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H16N4/c17-14-7-12-9-18-20-15(12)8-16(14)19-13-5-10-3-1-2-4-11(10)6-13/h1-4,7-9,13,19H,5-6,17H2,(H,18,20) |
| InChIKey | HOHBSSIZRPVECO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|