C15H14N4O — CID 107490352
6-N-(2,3-dihydro-1-benzofuran-3-yl)-1H-indazole-5,6-diamine (PubChem CID 107490352) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-N-(2,3-dihydro-1-benzofuran-3-yl)-1H-indazole-5,6-diamine.
| Compound Name | 6-N-(2,3-dihydro-1-benzofuran-3-yl)-1H-indazole-5,6-diamine |
|---|---|
| PubChem CID | 107490352 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-N-(2,3-dihydro-1-benzofuran-3-yl)-1H-indazole-5,6-diamine |
| SMILES | Nc1cc2cn[nH]c2cc1NC1COc2ccccc21 |
| InChI | InChI=1S/C15H14N4O/c16-11-5-9-7-17-19-12(9)6-13(11)18-14-8-20-15-4-2-1-3-10(14)15/h1-7,14,18H,8,16H2,(H,17,19) |
| InChIKey | PWIISYHYZCJTBC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|