C14H13ClN2O — CID 104834591
3-chloro-1-N-(2,3-dihydro-1-benzofuran-3-yl)benzene-1,2-diamine (PubChem CID 104834591) has the molecular formula C14H13ClN2O and a molecular weight of 260.72 g/mol. Its IUPAC name is 3-chloro-1-N-(2,3-dihydro-1-benzofuran-3-yl)benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(2,3-dihydro-1-benzofuran-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 104834591 |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3-chloro-1-N-(2,3-dihydro-1-benzofuran-3-yl)benzene-1,2-diamine |
| SMILES | Nc1c(Cl)cccc1NC1COc2ccccc21 |
| InChI | InChI=1S/C14H13ClN2O/c15-10-5-3-6-11(14(10)16)17-12-8-18-13-7-2-1-4-9(12)13/h1-7,12,17H,8,16H2 |
| InChIKey | CUOXRZAPRRQGGF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|