About 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine
3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine (PubChem CID 104834789) has the molecular formula C11H15ClN2O
and a molecular weight of 226.71 g/mol. Its IUPAC name is 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine.
Molecular Properties
| Compound Name | 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine |
| PubChem CID | 104834789 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine |
| SMILES | CC1OCCC1Nc1cccc(Cl)c1N |
| InChI | InChI=1S/C11H15ClN2O/c1-7-9(5-6-15-7)14-10-4-2-3-8(12)11(10)13/h2-4,7,9,14H,5-6,13H2,1H3 |
| InChIKey | RDEXSXNQESXQHX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine?
The IUPAC name of 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine (CID 104834789) is 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine.
What is the SMILES notation for 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine?
The canonical SMILES for 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine is CC1OCCC1Nc1cccc(Cl)c1N.
What is the InChIKey of 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine?
The InChIKey is RDEXSXNQESXQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O/c1-7-9(5-6-15-7)14-10-4-2-3-8(12)11(10)13/h2-4,7,9,14H,5-6,13H2,1H3.
What are the key properties of 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine?
3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine has a molecular weight of 226.71 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine is sourced from PubChem (CID 104834789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).