C11H15ClN2O — CID 104834789
3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine (PubChem CID 104834789) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 104834789 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-chloro-1-N-(2-methyloxolan-3-yl)benzene-1,2-diamine |
| SMILES | CC1OCCC1Nc1cccc(Cl)c1N |
| InChI | InChI=1S/C11H15ClN2O/c1-7-9(5-6-15-7)14-10-4-2-3-8(12)11(10)13/h2-4,7,9,14H,5-6,13H2,1H3 |
| InChIKey | RDEXSXNQESXQHX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|