C11H16N2O — CID 82726024
2-N-(2-methyloxolan-3-yl)benzene-1,2-diamine (PubChem CID 82726024) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-N-(2-methyloxolan-3-yl)benzene-1,2-diamine.
| Compound Name | 2-N-(2-methyloxolan-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 82726024 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-N-(2-methyloxolan-3-yl)benzene-1,2-diamine |
| SMILES | CC1OCCC1Nc1ccccc1N |
| InChI | InChI=1S/C11H16N2O/c1-8-10(6-7-14-8)13-11-5-3-2-4-9(11)12/h2-5,8,10,13H,6-7,12H2,1H3 |
| InChIKey | DSGBAJSEQVWPDY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|