C13H19NO — CID 97358541
(2S,3R)-N-(2-ethylphenyl)-2-methyloxolan-3-amine (PubChem CID 97358541) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2S,3R)-N-(2-ethylphenyl)-2-methyloxolan-3-amine.
| Compound Name | (2S,3R)-N-(2-ethylphenyl)-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 97358541 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2S,3R)-N-(2-ethylphenyl)-2-methyloxolan-3-amine |
| SMILES | CCc1ccccc1N[C@@H]1CCO[C@H]1C |
| InChI | InChI=1S/C13H19NO/c1-3-11-6-4-5-7-13(11)14-12-8-9-15-10(12)2/h4-7,10,12,14H,3,8-9H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | WBQGTQYMXLOQSN-CMPLNLGQSA-N |
| XLogP | 2.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |