C15H11FN2O — CID 78983698
2-(2,3-dihydro-1-benzofuran-3-ylamino)-6-fluorobenzonitrile (PubChem CID 78983698) has the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-3-ylamino)-6-fluorobenzonitrile.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-3-ylamino)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 78983698 |
| Molecular Formula | C15H11FN2O |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-3-ylamino)-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1NC1COc2ccccc21 |
| InChI | InChI=1S/C15H11FN2O/c16-12-5-3-6-13(11(12)8-17)18-14-9-19-15-7-2-1-4-10(14)15/h1-7,14,18H,9H2 |
| InChIKey | JMFIXASGNRXIPZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |