C15H11BrN2O — CID 114901907
4-bromo-2-(2,3-dihydro-1-benzofuran-3-ylamino)benzonitrile (PubChem CID 114901907) has the molecular formula C15H11BrN2O and a molecular weight of 315.17 g/mol. Its IUPAC name is 4-bromo-2-(2,3-dihydro-1-benzofuran-3-ylamino)benzonitrile.
| Compound Name | 4-bromo-2-(2,3-dihydro-1-benzofuran-3-ylamino)benzonitrile |
|---|---|
| PubChem CID | 114901907 |
| Molecular Formula | C15H11BrN2O |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-bromo-2-(2,3-dihydro-1-benzofuran-3-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(Br)cc1NC1COc2ccccc21 |
| InChI | InChI=1S/C15H11BrN2O/c16-11-6-5-10(8-17)13(7-11)18-14-9-19-15-4-2-1-3-12(14)15/h1-7,14,18H,9H2 |
| InChIKey | WWMATMJNSJVWBL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |