C14H12ClNO3S — CID 110751703
2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzenesulfonamide (PubChem CID 110751703) has the molecular formula C14H12ClNO3S and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110751703 |
| Molecular Formula | C14H12ClNO3S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-chloro-N-(2,3-dihydro-1-benzofuran-3-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1COc2ccccc21)c1ccccc1Cl |
| InChI | InChI=1S/C14H12ClNO3S/c15-11-6-2-4-8-14(11)20(17,18)16-12-9-19-13-7-3-1-5-10(12)13/h1-8,12,16H,9H2 |
| InChIKey | XSZOIORYZKOVQT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |