C10H14N2O3S — CID 110751655
3-(dimethylsulfamoylamino)-2,3-dihydro-1-benzofuran (PubChem CID 110751655) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-(dimethylsulfamoylamino)-2,3-dihydro-1-benzofuran.
| Compound Name | 3-(dimethylsulfamoylamino)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 110751655 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-(dimethylsulfamoylamino)-2,3-dihydro-1-benzofuran |
| SMILES | CN(C)S(=O)(=O)NC1COc2ccccc21 |
| InChI | InChI=1S/C10H14N2O3S/c1-12(2)16(13,14)11-9-7-15-10-6-4-3-5-8(9)10/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | UJAZPWIJUFUARV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |