C15H22N2O3S — CID 95592046
(3S)-3-[[cyclohexyl(methyl)sulfamoyl]amino]-2,3-dihydro-1-benzofuran (PubChem CID 95592046) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (3S)-3-[[cyclohexyl(methyl)sulfamoyl]amino]-2,3-dihydro-1-benzofuran.
| Compound Name | (3S)-3-[[cyclohexyl(methyl)sulfamoyl]amino]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 95592046 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3S)-3-[[cyclohexyl(methyl)sulfamoyl]amino]-2,3-dihydro-1-benzofuran |
| SMILES | CN(C1CCCCC1)S(=O)(=O)N[C@@H]1COc2ccccc21 |
| InChI | InChI=1S/C15H22N2O3S/c1-17(12-7-3-2-4-8-12)21(18,19)16-14-11-20-15-10-6-5-9-13(14)15/h5-6,9-10,12,14,16H,2-4,7-8,11H2,1H3/t14-/m1/s1 |
| InChIKey | BBEJEKHTWBUQAM-CQSZACIVSA-N |
| XLogP | 2.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |