C16H24N2O — CID 60725605
3-N-cyclohexyl-3-N-methyl-3,4-dihydro-2H-chromene-3,4-diamine (PubChem CID 60725605) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-N-cyclohexyl-3-N-methyl-3,4-dihydro-2H-chromene-3,4-diamine.
| Compound Name | 3-N-cyclohexyl-3-N-methyl-3,4-dihydro-2H-chromene-3,4-diamine |
|---|---|
| PubChem CID | 60725605 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-N-cyclohexyl-3-N-methyl-3,4-dihydro-2H-chromene-3,4-diamine |
| SMILES | CN(C1CCCCC1)C1COc2ccccc2C1N |
| InChI | InChI=1S/C16H24N2O/c1-18(12-7-3-2-4-8-12)14-11-19-15-10-6-5-9-13(15)16(14)17/h5-6,9-10,12,14,16H,2-4,7-8,11,17H2,1H3 |
| InChIKey | UCZBIMAMSMCPOC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |