C13H20N2O — CID 43184438
3-N,3-N-diethyl-3,4-dihydro-2H-chromene-3,4-diamine (PubChem CID 43184438) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-N,3-N-diethyl-3,4-dihydro-2H-chromene-3,4-diamine.
| Compound Name | 3-N,3-N-diethyl-3,4-dihydro-2H-chromene-3,4-diamine |
|---|---|
| PubChem CID | 43184438 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-N,3-N-diethyl-3,4-dihydro-2H-chromene-3,4-diamine |
| SMILES | CCN(CC)C1COc2ccccc2C1N |
| InChI | InChI=1S/C13H20N2O/c1-3-15(4-2)11-9-16-12-8-6-5-7-10(12)13(11)14/h5-8,11,13H,3-4,9,14H2,1-2H3 |
| InChIKey | MYAZPNCNGNBSIL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |