C8H9NO — CID 40787193
(3R)-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 40787193) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is (3R)-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | (3R)-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 40787193 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | (3R)-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | N[C@H]1COc2ccccc21 |
| InChI | InChI=1S/C8H9NO/c9-7-5-10-8-4-2-1-3-6(7)8/h1-4,7H,5,9H2/t7-/m0/s1 |
| InChIKey | PLCGAGSBVAGXMP-ZETCQYMHSA-N |
| XLogP | 1.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |