C8H7IO — CID 154708354
3-iodo-2,3-dihydro-1-benzofuran (PubChem CID 154708354) has the molecular formula C8H7IO and a molecular weight of 246.05 g/mol. Its IUPAC name is 3-iodo-2,3-dihydro-1-benzofuran.
| Compound Name | 3-iodo-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 154708354 |
| Molecular Formula | C8H7IO |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 3-iodo-2,3-dihydro-1-benzofuran |
| SMILES | IC1COc2ccccc21 |
| InChI | InChI=1S/C8H7IO/c9-7-5-10-8-4-2-1-3-6(7)8/h1-4,7H,5H2 |
| InChIKey | RGJMXZVIDPIGRN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|