C8H9BO3 — CID 66877807
2,3-dihydro-1-benzofuran-3-ylboronic acid (PubChem CID 66877807) has the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-3-ylboronic acid.
| Compound Name | 2,3-dihydro-1-benzofuran-3-ylboronic acid |
|---|---|
| PubChem CID | 66877807 |
| Molecular Formula | C8H9BO3 |
| Molecular Weight | 163.97 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-3-ylboronic acid |
| SMILES | OB(O)C1COc2ccccc21 |
| InChI | InChI=1S/C8H9BO3/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-4,7,10-11H,5H2 |
| InChIKey | LAKDSRUFQIZIJV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.97 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|