C12H18O2 — CID 90924294
3,4-dimethyl-3,4-dihydro-2H-chromene;methanol (PubChem CID 90924294) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-dihydro-2H-chromene;methanol.
| Compound Name | 3,4-dimethyl-3,4-dihydro-2H-chromene;methanol |
|---|---|
| PubChem CID | 90924294 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 3,4-dimethyl-3,4-dihydro-2H-chromene;methanol |
| SMILES | CC1COc2ccccc2C1C.CO |
| InChI | InChI=1S/C11H14O.CH4O/c1-8-7-12-11-6-4-3-5-10(11)9(8)2;1-2/h3-6,8-9H,7H2,1-2H3;2H,1H3 |
| InChIKey | FKCOGWIBVBSAGX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |