C12H16O — CID 129157836
(3S)-3-tert-butyl-2,3-dihydro-1-benzofuran (PubChem CID 129157836) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (3S)-3-tert-butyl-2,3-dihydro-1-benzofuran.
| Compound Name | (3S)-3-tert-butyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 129157836 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (3S)-3-tert-butyl-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)(C)[C@@H]1COc2ccccc21 |
| InChI | InChI=1S/C12H16O/c1-12(2,3)10-8-13-11-7-5-4-6-9(10)11/h4-7,10H,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | OLOSAXBUJPWQEG-SNVBAGLBSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |