C9H9IO — CID 146562180
(4S)-4-iodo-3,4-dihydro-2H-chromene (PubChem CID 146562180) has the molecular formula C9H9IO and a molecular weight of 260.07 g/mol. Its IUPAC name is (4S)-4-iodo-3,4-dihydro-2H-chromene.
| Compound Name | (4S)-4-iodo-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 146562180 |
| Molecular Formula | C9H9IO |
| Molecular Weight | 260.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | (4S)-4-iodo-3,4-dihydro-2H-chromene |
| SMILES | I[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C9H9IO/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8H,5-6H2/t8-/m0/s1 |
| InChIKey | NVXYHEHKVWGTEM-QMMMGPOBSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.07 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|