C13H20O — CID 169111717
ethane;4-ethyl-3,4-dihydro-2H-chromene (PubChem CID 169111717) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is ethane;4-ethyl-3,4-dihydro-2H-chromene.
| Compound Name | ethane;4-ethyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 169111717 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | ethane;4-ethyl-3,4-dihydro-2H-chromene |
| SMILES | CC.CCC1CCOc2ccccc21 |
| InChI | InChI=1S/C11H14O.C2H6/c1-2-9-7-8-12-11-6-4-3-5-10(9)11;1-2/h3-6,9H,2,7-8H2,1H3;1-2H3 |
| InChIKey | NLQDDDVYRHDEQG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |