C15H22BrNO — CID 113451450
N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)propan-1-amine (PubChem CID 113451450) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)propan-1-amine.
| Compound Name | N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 113451450 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)propan-1-amine |
| SMILES | CCCN(CCBr)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C15H22BrNO/c1-2-9-17(10-8-16)12-13-7-11-18-15-6-4-3-5-14(13)15/h3-6,13H,2,7-12H2,1H3 |
| InChIKey | NXKUYIZJEIHNIC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|