C15H20BrNO — CID 104771418
N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)cyclopropanamine (PubChem CID 104771418) has the molecular formula C15H20BrNO and a molecular weight of 310.23 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)cyclopropanamine.
| Compound Name | N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 104771418 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(2-bromoethyl)-N-(3,4-dihydro-2H-chromen-4-ylmethyl)cyclopropanamine |
| SMILES | BrCCN(CC1CCOc2ccccc21)C1CC1 |
| InChI | InChI=1S/C15H20BrNO/c16-8-9-17(13-5-6-13)11-12-7-10-18-15-4-2-1-3-14(12)15/h1-4,12-13H,5-11H2 |
| InChIKey | HYJUCMBVHREMDJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|