C16H22BrN — CID 80668709
N-(2-bromoethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclopropanamine (PubChem CID 80668709) has the molecular formula C16H22BrN and a molecular weight of 308.26 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclopropanamine.
| Compound Name | N-(2-bromoethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 80668709 |
| Molecular Formula | C16H22BrN |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(2-bromoethyl)-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)cyclopropanamine |
| SMILES | BrCCN(CC1CCCc2ccccc21)C1CC1 |
| InChI | InChI=1S/C16H22BrN/c17-10-11-18(15-8-9-15)12-14-6-3-5-13-4-1-2-7-16(13)14/h1-2,4,7,14-15H,3,5-6,8-12H2 |
| InChIKey | CWVNLRNQPBECAD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|