C17H24ClN — CID 66394307
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-N-(2-chloroethyl)cyclohexanamine (PubChem CID 66394307) has the molecular formula C17H24ClN and a molecular weight of 277.84 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-N-(2-chloroethyl)cyclohexanamine.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-N-(2-chloroethyl)cyclohexanamine |
|---|---|
| PubChem CID | 66394307 |
| Molecular Formula | C17H24ClN |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-N-(2-chloroethyl)cyclohexanamine |
| SMILES | ClCCN(CC1Cc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C17H24ClN/c18-10-11-19(16-7-2-1-3-8-16)13-15-12-14-6-4-5-9-17(14)15/h4-6,9,15-16H,1-3,7-8,10-13H2 |
| InChIKey | VSVQLJZEYBHYTK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|