C16H22ClNS — CID 102860429
N-(3-chloropropyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)cyclobutanamine (PubChem CID 102860429) has the molecular formula C16H22ClNS and a molecular weight of 295.88 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)cyclobutanamine.
| Compound Name | N-(3-chloropropyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)cyclobutanamine |
|---|---|
| PubChem CID | 102860429 |
| Molecular Formula | C16H22ClNS |
| Molecular Weight | 295.88 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(3-chloropropyl)-N-(2,3-dihydro-1-benzothiophen-3-ylmethyl)cyclobutanamine |
| SMILES | ClCCCN(CC1CSc2ccccc21)C1CCC1 |
| InChI | InChI=1S/C16H22ClNS/c17-9-4-10-18(14-5-3-6-14)11-13-12-19-16-8-2-1-7-15(13)16/h1-2,7-8,13-14H,3-6,9-12H2 |
| InChIKey | DRMKVMMYXBHVLL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|